C16H29Br3N2O6 — CID 167509059
2,2,2-tribromoethyl 2-[[2-formamido-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propyl]amino]acetate (PubChem CID 167509059) has the molecular formula C16H29Br3N2O6 and a molecular weight of 585.13 g/mol. Its IUPAC name is 2,2,2-tribromoethyl 2-[[2-formamido-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propyl]amino]acetate.
| Compound Name | 2,2,2-tribromoethyl 2-[[2-formamido-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propyl]amino]acetate |
|---|---|
| PubChem CID | 167509059 |
| Molecular Formula | C16H29Br3N2O6 |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 581.96 |
| IUPAC Name | 2,2,2-tribromoethyl 2-[[2-formamido-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propyl]amino]acetate |
| SMILES | CC(C)(C)OCCOCCOCC(CNCC(=O)OCC(Br)(Br)Br)NC=O |
| InChI | InChI=1S/C16H29Br3N2O6/c1-15(2,3)27-7-6-24-4-5-25-10-13(21-12-22)8-20-9-14(23)26-11-16(17,18)19/h12-13,20H,4-11H2,1-3H3,(H,21,22) |
| InChIKey | XVYQXOZJGPUIKB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|