C12H27FmN2O4- — CID 167509097
(2-aminoethylamino)methanone;fermium;2-[2-(2-methoxyethoxy)ethoxy]-2-methylpropane (PubChem CID 167509097) has the molecular formula C12H27FmN2O4- and a molecular weight of 520.36 g/mol. Its IUPAC name is (2-aminoethylamino)methanone;fermium;2-[2-(2-methoxyethoxy)ethoxy]-2-methylpropane.
| Compound Name | (2-aminoethylamino)methanone;fermium;2-[2-(2-methoxyethoxy)ethoxy]-2-methylpropane |
|---|---|
| PubChem CID | 167509097 |
| Molecular Formula | C12H27FmN2O4- |
| Molecular Weight | 520.36 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | (2-aminoethylamino)methanone;fermium;2-[2-(2-methoxyethoxy)ethoxy]-2-methylpropane |
| SMILES | COCCOCCOC(C)(C)C.NCCN[C-]=O.[Fm] |
| InChI | InChI=1S/C9H20O3.C3H7N2O.Fm/c1-9(2,3)12-8-7-11-6-5-10-4;4-1-2-5-3-6;/h5-8H2,1-4H3;1-2,4H2,(H,5,6);/q;-1; |
| InChIKey | YUJZSOKLELVWMN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|