C16H23ClFNO3 — CID 106508715
tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-3-hydroxy-2-methylpropyl]carbamate (PubChem CID 106508715) has the molecular formula C16H23ClFNO3 and a molecular weight of 331.82 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-3-hydroxy-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-3-hydroxy-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 106508715 |
| Molecular Formula | C16H23ClFNO3 |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | tert-butyl N-[2-[(3-chloro-4-fluorophenyl)methyl]-3-hydroxy-2-methylpropyl]carbamate |
| SMILES | CC(CO)(CNC(=O)OC(C)(C)C)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClFNO3/c1-15(2,3)22-14(21)19-9-16(4,10-20)8-11-5-6-13(18)12(17)7-11/h5-7,20H,8-10H2,1-4H3,(H,19,21) |
| InChIKey | MUZHEGNYBUJQDN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |