C26H43IN2O4 — CID 177072974
tert-butyl 2-[4-[4-(4-iodophenyl)butanoylamino]butyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]acetate (PubChem CID 177072974) has the molecular formula C26H43IN2O4 and a molecular weight of 574.54 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4-iodophenyl)butanoylamino]butyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]acetate.
| Compound Name | tert-butyl 2-[4-[4-(4-iodophenyl)butanoylamino]butyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]acetate |
|---|---|
| PubChem CID | 177072974 |
| Molecular Formula | C26H43IN2O4 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | tert-butyl 2-[4-[4-(4-iodophenyl)butanoylamino]butyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]acetate |
| SMILES | CC(C)(C)OCCN(CCCCNC(=O)CCCc1ccc(I)cc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43IN2O4/c1-25(2,3)32-19-18-29(20-24(31)33-26(4,5)6)17-8-7-16-28-23(30)11-9-10-21-12-14-22(27)15-13-21/h12-15H,7-11,16-20H2,1-6H3,(H,28,30) |
| InChIKey | BANXTESSWXCPLB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|