C23H31N3O3S — CID 56529953
S-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56529953) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is S-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56529953 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | S-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-26(2)22(29)30-19-5-3-18(4-6-19)25-20(27)7-8-24-21(28)23-12-15-9-16(13-23)11-17(10-15)14-23/h3-6,15-17H,7-14H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | FICIFRCIFUCEDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|