C26H33N3O5 — CID 16615520
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide (PubChem CID 16615520) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 16615520 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CCC1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C26H33N3O5/c1-3-33-23-17-22(29-11-13-32-14-12-29)24(34-4-2)16-21(23)27-25(30)10-9-19-15-18-7-5-6-8-20(18)28-26(19)31/h5-8,16-17,19H,3-4,9-15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | YXTNUVRDSALPLJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|