C24H28N2O6 — CID 25392373
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]acetamide (PubChem CID 25392373) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]acetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]acetamide |
|---|---|
| PubChem CID | 25392373 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H28N2O6/c1-3-30-21-14-19(26-9-11-29-12-10-26)22(31-4-2)13-18(21)25-23(27)15-20-16-7-5-6-8-17(16)24(28)32-20/h5-8,13-14,20H,3-4,9-12,15H2,1-2H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | ARRTZMJVAPAKRJ-FQEVSTJZSA-N |
| XLogP | 3.56 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|