C24H30N6O4 — CID 4968363
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 4968363) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4968363 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)Cn1nnc(-c2ccccc2C)n1 |
| InChI | InChI=1S/C24H30N6O4/c1-4-33-21-15-20(29-10-12-32-13-11-29)22(34-5-2)14-19(21)25-23(31)16-30-27-24(26-28-30)18-9-7-6-8-17(18)3/h6-9,14-15H,4-5,10-13,16H2,1-3H3,(H,25,31) |
| InChIKey | MRNLXPTVYSYSBS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|