C26H37N3O5 — CID 46630394
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]acetamide (PubChem CID 46630394) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]acetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 46630394 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[methyl-[2-(2-methylphenoxy)ethyl]amino]acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CN(C)CCOc1ccccc1C |
| InChI | InChI=1S/C26H37N3O5/c1-5-32-24-18-22(29-12-14-31-15-13-29)25(33-6-2)17-21(24)27-26(30)19-28(4)11-16-34-23-10-8-7-9-20(23)3/h7-10,17-18H,5-6,11-16,19H2,1-4H3,(H,27,30) |
| InChIKey | VNGQHIPXTXQLAS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|