C18H24N2O5S2 — CID 3691440
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)thiophene-2-sulfonamide (PubChem CID 3691440) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3691440 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)thiophene-2-sulfonamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H24N2O5S2/c1-3-24-16-13-15(20-7-9-23-10-8-20)17(25-4-2)12-14(16)19-27(21,22)18-6-5-11-26-18/h5-6,11-13,19H,3-4,7-10H2,1-2H3 |
| InChIKey | KEKKSOVRRBVLNT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|