C19H27ClN4O5S — CID 3701408
5-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 3701408) has the molecular formula C19H27ClN4O5S and a molecular weight of 458.97 g/mol. Its IUPAC name is 5-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | 5-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 3701408 |
| Molecular Formula | C19H27ClN4O5S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C19H27ClN4O5S/c1-5-28-16-12-15(24-7-9-27-10-8-24)17(29-6-2)11-14(16)22-30(25,26)18-13(3)21-23(4)19(18)20/h11-12,22H,5-10H2,1-4H3 |
| InChIKey | QBFVVUIZMSDODT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|