C22H28N2O8S — CID 55879787
methyl 5-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-2-hydroxybenzoate (PubChem CID 55879787) has the molecular formula C22H28N2O8S and a molecular weight of 480.54 g/mol. Its IUPAC name is methyl 5-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 55879787 |
| Molecular Formula | C22H28N2O8S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | methyl 5-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-2-hydroxybenzoate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1ccc(O)c(C(=O)OC)c1 |
| InChI | InChI=1S/C22H28N2O8S/c1-4-31-20-14-18(24-8-10-30-11-9-24)21(32-5-2)13-17(20)23-33(27,28)15-6-7-19(25)16(12-15)22(26)29-3/h6-7,12-14,23,25H,4-5,8-11H2,1-3H3 |
| InChIKey | XZBPJGOOWRVOFA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|