C23H31N3O7S — CID 4847534
N-[3-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-4-methoxyphenyl]acetamide (PubChem CID 4847534) has the molecular formula C23H31N3O7S and a molecular weight of 493.58 g/mol. Its IUPAC name is N-[3-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 4847534 |
| Molecular Formula | C23H31N3O7S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[3-[(2,5-diethoxy-4-morpholin-4-ylphenyl)sulfamoyl]-4-methoxyphenyl]acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1cc(NC(C)=O)ccc1OC |
| InChI | InChI=1S/C23H31N3O7S/c1-5-32-21-15-19(26-9-11-31-12-10-26)22(33-6-2)14-18(21)25-34(28,29)23-13-17(24-16(3)27)7-8-20(23)30-4/h7-8,13-15,25H,5-6,9-12H2,1-4H3,(H,24,27) |
| InChIKey | MGEUVJZNEDBNAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|