About 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide
4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide (PubChem CID 3667102) has the molecular formula C22H28N2O6S
and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide |
| PubChem CID | 3667102 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H28N2O6S/c1-4-29-21-15-20(24-10-12-28-13-11-24)22(30-5-2)14-19(21)23-31(26,27)18-8-6-17(7-9-18)16(3)25/h6-9,14-15,23H,4-5,10-13H2,1-3H3 |
| InChIKey | FRRLVFXXFQZCKS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide?
The IUPAC name of 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide (CID 3667102) is 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide?
The canonical SMILES for 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide is CCOc1cc(N2CCOCC2)c(OCC)cc1NS(=O)(=O)c1ccc(C(C)=O)cc1.
What is the InChIKey of 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide?
The InChIKey is FRRLVFXXFQZCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O6S/c1-4-29-21-15-20(24-10-12-28-13-11-24)22(30-5-2)14-19(21)23-31(26,27)18-8-6-17(7-9-18)16(3)25/h6-9,14-15,23H,4-5,10-13H2,1-3H3.
What are the key properties of 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide?
4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide has a molecular weight of 448.54 g/mol, XLogP of 3.32, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzenesulfonamide is sourced from PubChem (CID 3667102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).