C32H36N4O7S — CID 4590712
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[3-(3,4-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4590712) has the molecular formula C32H36N4O7S and a molecular weight of 620.73 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[3-(3,4-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[3-(3,4-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4590712 |
| Molecular Formula | C32H36N4O7S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[3-(3,4-dimethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H36N4O7S/c1-5-42-27-19-25(35-13-15-41-16-14-35)28(43-6-2)18-24(27)33-30(37)20-44-32-34-23-10-8-7-9-22(23)31(38)36(32)21-11-12-26(39-3)29(17-21)40-4/h7-12,17-19H,5-6,13-16,20H2,1-4H3,(H,33,37) |
| InChIKey | QWTHYLADDMIMER-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|