C22H24N4O2S — CID 40684880
2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 40684880) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 40684880 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(-n2ccnc2SCC(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c1-28-20-9-7-19(8-10-20)26-12-11-23-22(26)29-17-21(27)25-15-13-24(14-16-25)18-5-3-2-4-6-18/h2-12H,13-17H2,1H3 |
| InChIKey | IZXBWODMJXVYPV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |