C21H26ClN5O4S — CID 3971991
2-[4-chloro-6-[4-(4-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide (PubChem CID 3971991) has the molecular formula C21H26ClN5O4S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-[4-chloro-6-[4-(4-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide.
| Compound Name | 2-[4-chloro-6-[4-(4-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide |
|---|---|
| PubChem CID | 3971991 |
| Molecular Formula | C21H26ClN5O4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-[4-chloro-6-[4-(4-methoxybenzoyl)-3-methylpiperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide |
| SMILES | CCONC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)c3ccc(OC)cc3)C(C)C2)n1 |
| InChI | InChI=1S/C21H26ClN5O4S/c1-4-31-25-19(28)13-32-21-23-17(22)11-18(24-21)26-9-10-27(14(2)12-26)20(29)15-5-7-16(30-3)8-6-15/h5-8,11,14H,4,9-10,12-13H2,1-3H3,(H,25,28) |
| InChIKey | MECLVFPFXSTTIX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|