C21H26ClN5O3S — CID 42662773
2-[4-chloro-6-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide (PubChem CID 42662773) has the molecular formula C21H26ClN5O3S and a molecular weight of 463.99 g/mol. Its IUPAC name is 2-[4-chloro-6-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide.
| Compound Name | 2-[4-chloro-6-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide |
|---|---|
| PubChem CID | 42662773 |
| Molecular Formula | C21H26ClN5O3S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-[4-chloro-6-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]pyrimidin-2-yl]sulfanyl-N-ethoxyacetamide |
| SMILES | CCONC(=O)CSc1nc(Cl)cc(N2CCN(C(=O)c3ccc(C)cc3)C(C)C2)n1 |
| InChI | InChI=1S/C21H26ClN5O3S/c1-4-30-25-19(28)13-31-21-23-17(22)11-18(24-21)26-9-10-27(15(3)12-26)20(29)16-7-5-14(2)6-8-16/h5-8,11,15H,4,9-10,12-13H2,1-3H3,(H,25,28) |
| InChIKey | HDYGNQDLLAXUQI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|