C18H17Cl2N5OS — CID 27963414
2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 27963414) has the molecular formula C18H17Cl2N5OS and a molecular weight of 422.34 g/mol. Its IUPAC name is 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 27963414 |
| Molecular Formula | C18H17Cl2N5OS |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnc2c(Cl)cc(Cl)cn12)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C18H17Cl2N5OS/c19-12-9-15(20)17-22-23-18(25(17)10-12)27-11-16(26)21-13-3-5-14(6-4-13)24-7-1-2-8-24/h3-6,9-10H,1-2,7-8,11H2,(H,21,26) |
| InChIKey | BJFLLRWTLPWOMU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|