C20H22F3N3O2S — CID 55917636
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (PubChem CID 55917636) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 55917636 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| SMILES | COc1ccc(N2CCCN(C(=O)CSc3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O2S/c1-28-17-6-4-16(5-7-17)25-9-2-10-26(12-11-25)19(27)14-29-18-8-3-15(13-24-18)20(21,22)23/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | WBHOLAFYNITLGQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|