C19H24ClN3O4S — CID 55452318
1-[4-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55452318) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is 1-[4-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55452318 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 1-[4-[2-[(3-chlorophenyl)methylsulfanyl]acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | O=C(CSCc1cccc(Cl)c1)N1CCN(C(=O)C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H24ClN3O4S/c20-16-3-1-2-15(12-16)13-28-14-17(24)21-4-6-22(7-5-21)18(25)19(26)23-8-10-27-11-9-23/h1-3,12H,4-11,13-14H2 |
| InChIKey | HXXLQZRBSOKGRJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|