C13H16ClNO3S2 — CID 112733684
methyl 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate (PubChem CID 112733684) has the molecular formula C13H16ClNO3S2 and a molecular weight of 333.86 g/mol. Its IUPAC name is methyl 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 112733684 |
| Molecular Formula | C13H16ClNO3S2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | methyl 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CSCc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H16ClNO3S2/c1-18-13(17)9-4-5-15(6-9)12(16)8-19-7-10-2-3-11(14)20-10/h2-3,9H,4-8H2,1H3 |
| InChIKey | JAIMICUYFWUEKT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |