C13H16ClNO3S2 — CID 43171079
1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]piperidine-2-carboxylic acid (PubChem CID 43171079) has the molecular formula C13H16ClNO3S2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43171079 |
| Molecular Formula | C13H16ClNO3S2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H16ClNO3S2/c14-11-5-4-9(20-11)7-19-8-12(16)15-6-2-1-3-10(15)13(17)18/h4-5,10H,1-3,6-8H2,(H,17,18) |
| InChIKey | AJYWHNMHZZXZNP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |