C13H13BrClNO4S — CID 54052188
(2S)-1-[3-bromo-4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54052188) has the molecular formula C13H13BrClNO4S and a molecular weight of 394.67 g/mol. Its IUPAC name is (2S)-1-[3-bromo-4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-bromo-4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54052188 |
| Molecular Formula | C13H13BrClNO4S |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | (2S)-1-[3-bromo-4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(c1ccc(Cl)s1)C(Br)CC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H13BrClNO4S/c14-7(12(18)9-3-4-10(15)21-9)6-11(17)16-5-1-2-8(16)13(19)20/h3-4,7-8H,1-2,5-6H2,(H,19,20)/t7?,8-/m0/s1 |
| InChIKey | LTRNOVOARXVDMQ-MQWKRIRWSA-N |
| XLogP | 2.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|