C18H19F3N2O3S2 — CID 133210632
1-thiophen-2-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 133210632) has the molecular formula C18H19F3N2O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-thiophen-2-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133210632 |
| Molecular Formula | C18H19F3N2O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H19F3N2O3S2/c19-18(20,21)15-6-1-4-13(10-15)11-22-17(24)14-5-2-8-23(12-14)28(25,26)16-7-3-9-27-16/h1,3-4,6-7,9-10,14H,2,5,8,11-12H2,(H,22,24) |
| InChIKey | UKJIDQLKMVPBQV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |