C21H27N3O3S2 — CID 35615339
(3S)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 35615339) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (3S)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 35615339 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (3S)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)cc1)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C21H27N3O3S2/c25-21(22-15-17-7-9-19(10-8-17)23-11-1-2-12-23)18-5-3-13-24(16-18)29(26,27)20-6-4-14-28-20/h4,6-10,14,18H,1-3,5,11-13,15-16H2,(H,22,25)/t18-/m0/s1 |
| InChIKey | ZJCCGOPBBBZCMH-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|