C20H26N3O5S+ — CID 8901522
N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 8901522) has the molecular formula C20H26N3O5S+ and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 8901522 |
| Molecular Formula | C20H26N3O5S+ |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CCNC(=O)C[NH+]3CCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C20H25N3O5S/c1-27-15-6-5-14(11-16(15)28-2)12-17-19(25)23(20(26)29-17)10-7-21-18(24)13-22-8-3-4-9-22/h5-6,11-12H,3-4,7-10,13H2,1-2H3,(H,21,24)/p+1/b17-12- |
| InChIKey | NIQVLYCIZHIQSU-ATVHPVEESA-O |
| XLogP | 0.54 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|