C24H27N3O6S — CID 55755249
2-methoxyethyl 2,4-dimethyl-5-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 55755249) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55755249 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)NCCN2C(=O)SC(=Cc3ccc(C)cc3)C2=O)c1C |
| InChI | InChI=1S/C24H27N3O6S/c1-14-5-7-17(8-6-14)13-18-22(29)27(24(31)34-18)10-9-25-21(28)20-15(2)19(16(3)26-20)23(30)33-12-11-32-4/h5-8,13,26H,9-12H2,1-4H3,(H,25,28) |
| InChIKey | IKOASUJBWMVSQX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|