C26H30N4O4S — CID 55553771
2-(benzylcarbamoylamino)-3-methyl-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide (PubChem CID 55553771) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-3-methyl-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide.
| Compound Name | 2-(benzylcarbamoylamino)-3-methyl-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 55553771 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-(benzylcarbamoylamino)-3-methyl-N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]butanamide |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(CCNC(=O)C(NC(=O)NCc3ccccc3)C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C26H30N4O4S/c1-17(2)22(29-25(33)28-16-20-7-5-4-6-8-20)23(31)27-13-14-30-24(32)21(35-26(30)34)15-19-11-9-18(3)10-12-19/h4-12,15,17,22H,13-14,16H2,1-3H3,(H,27,31)(H2,28,29,33)/b21-15- |
| InChIKey | PHAQFSSJWVLLOU-QNGOZBTKSA-N |
| XLogP | 3.67 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|