C25H27N3O5S — CID 55883185
benzyl N-[4-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-oxobutyl]carbamate (PubChem CID 55883185) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is benzyl N-[4-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55883185 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | benzyl N-[4-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]-4-oxobutyl]carbamate |
| SMILES | Cc1ccc(C=C2SC(=O)N(CCNC(=O)CCCNC(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-18-9-11-19(12-10-18)16-21-23(30)28(25(32)34-21)15-14-26-22(29)8-5-13-27-24(31)33-17-20-6-3-2-4-7-20/h2-4,6-7,9-12,16H,5,8,13-15,17H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | MQTJSZRBUIZALN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|