C19H19N3O5S3 — CID 2107132
3-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 2107132) has the molecular formula C19H19N3O5S3 and a molecular weight of 465.58 g/mol. Its IUPAC name is 3-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 2107132 |
| Molecular Formula | C19H19N3O5S3 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 3-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCN2C(=O)S/C(=C/c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C19H19N3O5S3/c20-30(26,27)15-5-3-13(4-6-15)7-9-21-17(23)8-10-22-18(24)16(29-19(22)25)12-14-2-1-11-28-14/h1-6,11-12H,7-10H2,(H,21,23)(H2,20,26,27)/b16-12+ |
| InChIKey | RMINAGBTYISMEU-FOWTUZBSSA-N |
| XLogP | 2.18 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|