C20H20N2O4S2 — CID 2093025
3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 2093025) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 2093025 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCN2C(=O)S/C(=C\c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-26-15-6-4-14(5-7-15)8-10-21-18(23)9-11-22-19(24)17(28-20(22)25)13-16-3-2-12-27-16/h2-7,12-13H,8-11H2,1H3,(H,21,23)/b17-13- |
| InChIKey | UUACPVOMDJLUNA-LGMDPLHJSA-N |
| XLogP | 3.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|