C19H18N2O3S2 — CID 51177293
2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(2-methylphenyl)ethyl]acetamide (PubChem CID 51177293) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 51177293 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(2-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1CCNC(=O)CN1C(=O)S/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C19H18N2O3S2/c1-13-5-2-3-6-14(13)8-9-20-17(22)12-21-18(23)16(26-19(21)24)11-15-7-4-10-25-15/h2-7,10-11H,8-9,12H2,1H3,(H,20,22)/b16-11- |
| InChIKey | KDNQSIZHSZWVFS-WJDWOHSUSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|