C13H14N2O3S2 — CID 51143857
2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-propylacetamide (PubChem CID 51143857) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-propylacetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 51143857 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1C(=O)S/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C13H14N2O3S2/c1-2-5-14-11(16)8-15-12(17)10(20-13(15)18)7-9-4-3-6-19-9/h3-4,6-7H,2,5,8H2,1H3,(H,14,16)/b10-7- |
| InChIKey | JFUTZSKYEXMSRW-YFHOEESVSA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|