C18H15ClN2O5S2 — CID 24619270
N-(4-chloro-2,5-dimethoxyphenyl)-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide (PubChem CID 24619270) has the molecular formula C18H15ClN2O5S2 and a molecular weight of 438.91 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 24619270 |
| Molecular Formula | C18H15ClN2O5S2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(NC(=O)CN2C(=O)S/C(=C\c3cccs3)C2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C18H15ClN2O5S2/c1-25-13-8-12(14(26-2)7-11(13)19)20-16(22)9-21-17(23)15(28-18(21)24)6-10-4-3-5-27-10/h3-8H,9H2,1-2H3,(H,20,22)/b15-6- |
| InChIKey | WDOZUEZZBBHVHE-UUASQNMZSA-N |
| XLogP | 4.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|