C19H16N2O3S3 — CID 24619196
2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 24619196) has the molecular formula C19H16N2O3S3 and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 24619196 |
| Molecular Formula | C19H16N2O3S3 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN1C(=O)S/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C19H16N2O3S3/c1-2-9-26-15-8-4-3-7-14(15)20-17(22)12-21-18(23)16(27-19(21)24)11-13-6-5-10-25-13/h2-8,10-11H,1,9,12H2,(H,20,22)/b16-11- |
| InChIKey | JGIJHSRFAXRAHQ-WJDWOHSUSA-N |
| XLogP | 4.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|