C19H13N3O3S2 — CID 24619298
2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-quinolin-5-ylacetamide (PubChem CID 24619298) has the molecular formula C19H13N3O3S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-quinolin-5-ylacetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-quinolin-5-ylacetamide |
|---|---|
| PubChem CID | 24619298 |
| Molecular Formula | C19H13N3O3S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-quinolin-5-ylacetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cccs2)C1=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C19H13N3O3S2/c23-17(21-15-7-1-6-14-13(15)5-2-8-20-14)11-22-18(24)16(27-19(22)25)10-12-4-3-9-26-12/h1-10H,11H2,(H,21,23)/b16-10- |
| InChIKey | XGYHRWAKKHLMIS-YBEGLDIGSA-N |
| XLogP | 3.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|