C20H15N3O3S3 — CID 55359336
2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 55359336) has the molecular formula C20H15N3O3S3 and a molecular weight of 441.56 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55359336 |
| Molecular Formula | C20H15N3O3S3 |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)CN3C(=O)S/C(=C\c4cccs4)C3=O)c2)cs1 |
| InChI | InChI=1S/C20H15N3O3S3/c1-12-21-16(11-28-12)13-4-2-5-14(8-13)22-18(24)10-23-19(25)17(29-20(23)26)9-15-6-3-7-27-15/h2-9,11H,10H2,1H3,(H,22,24)/b17-9- |
| InChIKey | ZXJRQCUIUYZDRX-MFOYZWKCSA-N |
| XLogP | 4.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|