C22H16N2O2S3 — CID 6204106
2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(4-phenylphenyl)acetamide (PubChem CID 6204106) has the molecular formula C22H16N2O2S3 and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 6204106 |
| Molecular Formula | C22H16N2O2S3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(4-phenylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccs2)SC1=S)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N2O2S3/c25-20(23-17-10-8-16(9-11-17)15-5-2-1-3-6-15)14-24-21(26)19(29-22(24)27)13-18-7-4-12-28-18/h1-13H,14H2,(H,23,25)/b19-13+ |
| InChIKey | RGQDODOAFBUFDZ-CPNJWEJPSA-N |
| XLogP | 5.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|