C16H10Cl2N2O2S3 — CID 3981782
N-(2,4-dichlorophenyl)-2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3981782) has the molecular formula C16H10Cl2N2O2S3 and a molecular weight of 429.38 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3981782 |
| Molecular Formula | C16H10Cl2N2O2S3 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)C(=Cc2cccs2)SC1=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl2N2O2S3/c17-9-3-4-12(11(18)6-9)19-14(21)8-20-15(22)13(25-16(20)23)7-10-2-1-5-24-10/h1-7H,8H2,(H,19,21) |
| InChIKey | FYXSDHYVOUZMPV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|