C16H13N3O2S3 — CID 4759734
2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N'-phenylacetohydrazide (PubChem CID 4759734) has the molecular formula C16H13N3O2S3 and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N'-phenylacetohydrazide.
| Compound Name | 2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 4759734 |
| Molecular Formula | C16H13N3O2S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N'-phenylacetohydrazide |
| SMILES | O=C(CN1C(=O)C(=Cc2cccs2)SC1=S)NNc1ccccc1 |
| InChI | InChI=1S/C16H13N3O2S3/c20-14(18-17-11-5-2-1-3-6-11)10-19-15(21)13(24-16(19)22)9-12-7-4-8-23-12/h1-9,17H,10H2,(H,18,20) |
| InChIKey | NJOGIIVVYQGISY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|