C15H16N2O2S3 — CID 7344287
(5E)-3-(2-oxo-2-piperidin-1-ylethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 7344287) has the molecular formula C15H16N2O2S3 and a molecular weight of 352.51 g/mol. Its IUPAC name is (5E)-3-(2-oxo-2-piperidin-1-ylethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-oxo-2-piperidin-1-ylethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7344287 |
| Molecular Formula | C15H16N2O2S3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (5E)-3-(2-oxo-2-piperidin-1-ylethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccs2)SC1=S)N1CCCCC1 |
| InChI | InChI=1S/C15H16N2O2S3/c18-13(16-6-2-1-3-7-16)10-17-14(19)12(22-15(17)20)9-11-5-4-8-21-11/h4-5,8-9H,1-3,6-7,10H2/b12-9+ |
| InChIKey | HTSMYGOCHZMRFM-FMIVXFBMSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|