C17H14N2OS2 — CID 30859343
(E)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 30859343) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (E)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 30859343 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (E)-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)/C=C/c3cccs3)c2)cs1 |
| InChI | InChI=1S/C17H14N2OS2/c1-12-18-16(11-22-12)13-4-2-5-14(10-13)19-17(20)8-7-15-6-3-9-21-15/h2-11H,1H3,(H,19,20)/b8-7+ |
| InChIKey | RBCUQYSOTYXXAM-BQYQJAHWSA-N |
| XLogP | 4.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|