C16H10Cl2N2OS2 — CID 1012057
N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 1012057) has the molecular formula C16H10Cl2N2OS2 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 1012057 |
| Molecular Formula | C16H10Cl2N2OS2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C16H10Cl2N2OS2/c17-12-5-3-10(8-13(12)18)14-9-23-16(19-14)20-15(21)6-4-11-2-1-7-22-11/h1-9H,(H,19,20,21) |
| InChIKey | KCRKXFXKPUDHLN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|