C21H19N3O3S2 — CID 2109863
3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 2109863) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 2109863 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 3-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)S/C(=C\c2cccs2)C1=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19N3O3S2/c25-19(22-9-7-14-13-23-17-6-2-1-5-16(14)17)8-10-24-20(26)18(29-21(24)27)12-15-4-3-11-28-15/h1-6,11-13,23H,7-10H2,(H,22,25)/b18-12- |
| InChIKey | VQUXPTRYHKWZMR-PDGQHHTCSA-N |
| XLogP | 4.01 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|