C22H21FN4O3S — CID 4894061
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide (PubChem CID 4894061) has the molecular formula C22H21FN4O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 4894061 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
| SMILES | Cn1cccc1C=C1SC(=O)N(CCC(=O)NCCc2c[nH]c3ccc(F)cc23)C1=O |
| InChI | InChI=1S/C22H21FN4O3S/c1-26-9-2-3-16(26)12-19-21(29)27(22(30)31-19)10-7-20(28)24-8-6-14-13-25-18-5-4-15(23)11-17(14)18/h2-5,9,11-13,25H,6-8,10H2,1H3,(H,24,28) |
| InChIKey | LLTJQXFUWTYPEO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|