C20H21N3O5S — CID 4973687
N-[2-(3,4-dihydroxyphenyl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide (PubChem CID 4973687) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 4973687 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-[5-[(1-methylpyrrol-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
| SMILES | Cn1cccc1C=C1SC(=O)N(CCC(=O)NCCc2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C20H21N3O5S/c1-22-9-2-3-14(22)12-17-19(27)23(20(28)29-17)10-7-18(26)21-8-6-13-4-5-15(24)16(25)11-13/h2-5,9,11-12,24-25H,6-8,10H2,1H3,(H,21,26) |
| InChIKey | ZKAHREVYQDABSZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|