C24H22ClN3O3S — CID 2517811
N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 2517811) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 2517811 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCCN1C(=O)S/C(=C/c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H22ClN3O3S/c25-18-10-8-16(9-11-18)14-21-23(30)28(24(31)32-21)13-12-26-22(29)7-3-4-17-15-27-20-6-2-1-5-19(17)20/h1-2,5-6,8-11,14-15,27H,3-4,7,12-13H2,(H,26,29)/b21-14+ |
| InChIKey | YMUQADPGXHCPDR-KGENOOAVSA-N |
| XLogP | 5.00 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|