C17H20N2O4S3 — CID 16629931
6-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid (PubChem CID 16629931) has the molecular formula C17H20N2O4S3 and a molecular weight of 412.56 g/mol. Its IUPAC name is 6-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid.
| Compound Name | 6-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 16629931 |
| Molecular Formula | C17H20N2O4S3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 6-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCN1C(=O)/C(=C/c2cccs2)SC1=S |
| InChI | InChI=1S/C17H20N2O4S3/c20-14(18-8-3-1-2-6-15(21)22)7-9-19-16(23)13(26-17(19)24)11-12-5-4-10-25-12/h4-5,10-11H,1-3,6-9H2,(H,18,20)(H,21,22)/b13-11- |
| InChIKey | JPTMYRJCJWTBGU-QBFSEMIESA-N |
| XLogP | 3.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|