C19H28N4O3S — CID 9043037
methyl 6-[[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]carbamothioylamino]hexanoate (PubChem CID 9043037) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is methyl 6-[[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 9043037 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | methyl 6-[[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N/N=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N4O3S/c1-25-18(24)5-3-2-4-10-20-19(27)22-21-15-16-6-8-17(9-7-16)23-11-13-26-14-12-23/h6-9,15H,2-5,10-14H2,1H3,(H2,20,22,27)/b21-15- |
| InChIKey | FAUQODWFRZIPEM-QNGOZBTKSA-N |
| XLogP | 2.05 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|